(3-chlorophenyl)-(3-methylphenyl)methanone
Modify Date: 2025-08-25 20:45:40
(3-chlorophenyl)-(3-methylphenyl)methanone structure
|
Common Name | (3-chlorophenyl)-(3-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 71372-41-3 | Molecular Weight | 230.69000 | |
| Density | 1.178g/cm3 | Boiling Point | 367.6ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | (3-chlorophenyl)-(3-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 367.6ºC at 760 mmHg |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.69000 |
| Flash Point | 198.5ºC |
| Exact Mass | 230.05000 |
| PSA | 17.07000 |
| LogP | 3.87940 |
| Index of Refraction | 1.586 |
| InChIKey | UWNSZCIJIQEGNQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)c2cccc(Cl)c2)c1 |
| HS Code | 2914700090 |
|---|
|
~14%
(3-chlorophenyl... CAS#:71372-41-3 |
| Literature: Goossen; Paetzold Advanced Synthesis and Catalysis, 2004 , vol. 346, # 13-15 p. 1665 - 1668 |
|
~%
Detail
|
| Literature: Kikukawa, Kiyoshi; Idemoto, Tohru; Katayama, Atsuhiko; Kono, Kiyoshi; Wada, Fumio; Matsuda, Tsutomu Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 1511 - 1514 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-Chloro-3'-methylbenzophenone |
| 3-Chlor-4'-methyl-benzophenon |
| 3-Methyl-3'-chlor-benzophenon |
| 3-Chlor-3'-methyl-benzophenon |