5,5'-dimethyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1-benzoxaphosphol-1-ium] structure
|
Common Name | 5,5'-dimethyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1-benzoxaphosphol-1-ium] | ||
|---|---|---|---|---|
| CAS Number | 71401-73-5 | Molecular Weight | 544.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H13F12O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5'-dimethyl-3,3,3',3'-tetrakis(trifluoromethyl)-1,1'-spirobi[2,1-benzoxaphosphol-1-ium] |
|---|
| Molecular Formula | C20H13F12O2P |
|---|---|
| Molecular Weight | 544.27100 |
| Exact Mass | 544.04600 |
| PSA | 32.05000 |
| LogP | 6.53430 |
| InChIKey | QIJLYROVPGAPFJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C(C(F)(F)F)(C(F)(F)F)O[P+]21OC(C(F)(F)F)(C(F)(F)F)c2cc(C)ccc21 |
|
~%
5,5'-dimethyl-3... CAS#:71401-73-5 |
| Literature: Granoth,I.; Martin,J.C. Journal of the American Chemical Society, 1979 , vol. 101, p. 4623 - 4626 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |