BOC-5-BROMO-DL-TRYPTOPHAN structure
|
Common Name | BOC-5-BROMO-DL-TRYPTOPHAN | ||
|---|---|---|---|---|
| CAS Number | 71422-81-6 | Molecular Weight | 254.20800 | |
| Density | 1.344g/cm3 | Boiling Point | 347.8ºC at 760 mmHg | |
| Molecular Formula | C12H9F3N2O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 164.2ºC | |
| Name | 4-[5-(trifluoromethyl)pyridin-2-yl]oxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 347.8ºC at 760 mmHg |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.20800 |
| Flash Point | 164.2ºC |
| Exact Mass | 254.06700 |
| PSA | 48.14000 |
| LogP | 4.05610 |
| Index of Refraction | 1.547 |
| InChIKey | LKVNUMLULPTKAU-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-{[5-(Trifluoromethyl)pyridin-2-yl]oxy}aniline |
| 4-([5-(trifluoromethyl)-2-pyridinyl]oxy)aniline |
| 4-[5-(trifluoromethyl)-2-pyridyloxy]phenylamine |