2-bromo-1,6,7-trimethoxy-3-methyl-naphthalene structure
|
Common Name | 2-bromo-1,6,7-trimethoxy-3-methyl-naphthalene | ||
|---|---|---|---|---|
| CAS Number | 7143-05-7 | Molecular Weight | 311.17100 | |
| Density | 1.364g/cm3 | Boiling Point | 400.1ºC at 760 mmHg | |
| Molecular Formula | C14H15BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.9ºC | |
| Name | 2-bromo-1,6,7-trimethoxy-3-methylnaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.364g/cm3 |
|---|---|
| Boiling Point | 400.1ºC at 760 mmHg |
| Molecular Formula | C14H15BrO3 |
| Molecular Weight | 311.17100 |
| Flash Point | 164.9ºC |
| Exact Mass | 310.02000 |
| PSA | 27.69000 |
| LogP | 3.93650 |
| Index of Refraction | 1.587 |
| InChIKey | XKVWYYLGQIWEHO-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(C)c(Br)c(OC)c2cc1OC |
|
~%
2-bromo-1,6,7-t... CAS#:7143-05-7 |
| Literature: Shirley; Dean Journal of the American Chemical Society, 1957 , vol. 79, p. 1205 |
|
~%
2-bromo-1,6,7-t... CAS#:7143-05-7 |
| Literature: Shirley; Dean Journal of the American Chemical Society, 1957 , vol. 79, p. 1205 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-bromo-1,6,7-trimethoxy-3-methyl-naphthalene |
| 2-Brom-1,6,7-trimethoxy-3-methyl-naphthalin |
| HMS3078A14 |