Propane,2-[[[(1,1-dimethylethyl)sulfonyl]methyl]sulfonyl]-2-methyl
Modify Date: 2025-08-24 21:10:05
![Propane,2-[[[(1,1-dimethylethyl)sulfonyl]methyl]sulfonyl]-2-methyl Structure](https://image.chemsrc.com/caspic/307/7144-89-0.png)
Propane,2-[[[(1,1-dimethylethyl)sulfonyl]methyl]sulfonyl]-2-methyl structure
|
Common Name | Propane,2-[[[(1,1-dimethylethyl)sulfonyl]methyl]sulfonyl]-2-methyl | ||
|---|---|---|---|---|
| CAS Number | 7144-89-0 | Molecular Weight | 256.38300 | |
| Density | 1.169g/cm3 | Boiling Point | 438.4ºC at 760 mmHg | |
| Molecular Formula | C9H20O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.1ºC | |
| Name | 2-(tert-butylsulfonylmethylsulfonyl)-2-methylpropane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 438.4ºC at 760 mmHg |
| Molecular Formula | C9H20O4S2 |
| Molecular Weight | 256.38300 |
| Flash Point | 271.1ºC |
| Exact Mass | 256.08000 |
| PSA | 85.04000 |
| LogP | 3.53210 |
| Index of Refraction | 1.471 |
| InChIKey | BLPNHXBJNOSJDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)(=O)CS(=O)(=O)C(C)(C)C |
| HS Code | 2904100000 |
|---|
|
~%
Propane,2-[[[(1... CAS#:7144-89-0 |
| Literature: Backer; Stedehouder Recueil des Travaux Chimiques des Pays-Bas, 1933 , vol. 52, p. 437,452 |
|
~%
Propane,2-[[[(1... CAS#:7144-89-0 |
| Literature: Backer; Stedehouder Recueil des Travaux Chimiques des Pays-Bas, 1933 , vol. 52, p. 437,452 |
|
~%
Propane,2-[[[(1... CAS#:7144-89-0 |
| Literature: Backer; Stedehouder Recueil des Travaux Chimiques des Pays-Bas, 1933 , vol. 52, p. 437,452 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Methylen-bis-tert.-butylsulfon |
| Bis(tert-Butylsulfonyl)methane |
| Bis-(tert-butylsulfonyl)-methan |
| bis-(1,1-dimethyl-ethanesulfonyl)-methane |
| propane,2,2'-(methylenedisulfonyl)bis[2-methyl |
| bis-(2-methyl-propane-2-sulfonyl)-methane |
| Bis-(1,1-dimethyl-aethansulfonyl)-methan |