Phosphoricacid, diethyl (3-methylphenyl)methyl ester structure
|
Common Name | Phosphoricacid, diethyl (3-methylphenyl)methyl ester | ||
|---|---|---|---|---|
| CAS Number | 7145-06-4 | Molecular Weight | 258.25100 | |
| Density | 1.116g/cm3 | Boiling Point | 336.8ºC at 760mmHg | |
| Molecular Formula | C12H19O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.2ºC | |
| Name | diethyl (3-methylphenyl)methyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 336.8ºC at 760mmHg |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25100 |
| Flash Point | 171.2ºC |
| Exact Mass | 258.10200 |
| PSA | 54.57000 |
| LogP | 3.69270 |
| Index of Refraction | 1.488 |
| InChIKey | RKOTXEBTOFHCTO-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)OCc1cccc(C)c1 |
|
~59%
Phosphoricacid,... CAS#:7145-06-4 |
| Literature: Givens, Richard S.; Matuszewski, Bogdan; Athey, Phillip S.; Robert Stoner Journal of the American Chemical Society, 1990 , vol. 112, # 16 p. 6016 - 6021 |
|
~%
Phosphoricacid,... CAS#:7145-06-4 |
| Literature: Alexander,B.H. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 626 - 632 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| m-methylbenzyl diethyl phosphate |
| Diethyl-(3-methyl-benzyl)-phosphat |
| diethyl 3-methylbenzyl phosphate |