1,3-dimethyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione structure
|
Common Name | 1,3-dimethyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7145-52-0 | Molecular Weight | 276.31400 | |
| Density | 1.44g/cm3 | Boiling Point | 569.9ºC at 760 mmHg | |
| Molecular Formula | C12H12N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.5ºC | |
| Name | 1,3-dimethyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 569.9ºC at 760 mmHg |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.31400 |
| Flash Point | 298.5ºC |
| Exact Mass | 276.06800 |
| PSA | 100.92000 |
| LogP | 0.61260 |
| Index of Refraction | 1.66 |
| InChIKey | NUMLXNCZORXRJO-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(Cc3cccs3)nc2n(C)c1=O |
|
~%
1,3-dimethyl-8-... CAS#:7145-52-0 |
| Literature: Hager et al. Journal of the American Pharmaceutical Association (1912-1977), 1954 , vol. 43, p. 152,154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |