9,10-Anthracenedione,1,3-diethoxy- structure
|
Common Name | 9,10-Anthracenedione,1,3-diethoxy- | ||
|---|---|---|---|---|
| CAS Number | 7146-02-3 | Molecular Weight | 296.31700 | |
| Density | 1.234g/cm3 | Boiling Point | 479.1ºC at 760mmHg | |
| Molecular Formula | C18H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.4ºC | |
| Name | 1,3-diethoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760mmHg |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.31700 |
| Flash Point | 213.4ºC |
| Exact Mass | 296.10500 |
| PSA | 52.60000 |
| LogP | 3.25940 |
| Index of Refraction | 1.592 |
| InChIKey | QQCRGOPFAVSJOT-UHFFFAOYSA-N |
| SMILES | CCOc1cc(OCC)c2c(c1)C(=O)c1ccccc1C2=O |
|
~%
9,10-Anthracene... CAS#:7146-02-3 |
| Literature: McElvain; Engelhardt Journal of the American Chemical Society, 1944 , vol. 66, p. 1077,1082 |
|
~%
9,10-Anthracene... CAS#:7146-02-3 |
| Literature: McElvain; Engelhardt Journal of the American Chemical Society, 1944 , vol. 66, p. 1077,1082 |
|
~%
9,10-Anthracene... CAS#:7146-02-3 |
| Literature: Plath Chemische Berichte, 1876 , vol. 9, p. 1204 |
|
~%
9,10-Anthracene... CAS#:7146-02-3 |
| Literature: McElvain; Engelhardt Journal of the American Chemical Society, 1944 , vol. 66, p. 1077,1082 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,3-Diethoxyanthrachinon |
| 9,10-Anthracenedione,1,3-diethoxy |
| 1,3-Diaethoxy-anthrachinon |
| 1,3-diethoxy-anthraquinone |