1-[3-(2-ethylhexanoyloxy)propylcarbamoyl]ethyl 2-ethylhexanoate structure
|
Common Name | 1-[3-(2-ethylhexanoyloxy)propylcarbamoyl]ethyl 2-ethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 7146-52-3 | Molecular Weight | 399.56500 | |
| Density | 0.984g/cm3 | Boiling Point | 522.7ºC at 760 mmHg | |
| Molecular Formula | C22H41NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.9ºC | |
| Name | 3-[2-(2-ethylhexanoyloxy)propanoylamino]propyl 2-ethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.984g/cm3 |
|---|---|
| Boiling Point | 522.7ºC at 760 mmHg |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.56500 |
| Flash Point | 269.9ºC |
| Exact Mass | 399.29800 |
| PSA | 81.70000 |
| LogP | 4.79130 |
| Index of Refraction | 1.459 |
| InChIKey | PIVXTLFIOLOFOJ-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OCCCNC(=O)C(C)OC(=O)C(CC)CCCC |
|
~%
1-[3-(2-ethylhe... CAS#:7146-52-3 |
| Literature: Fein; Filachione Journal of the American Chemical Society, 1953 , vol. 75, p. 2097 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-Aethyl-hexanoyloxy)-propionsaeure-[3-(2-aethyl-hexanoyloxy)-propylamid] |
| 3-({2-[(2-ethylhexanoyl)oxy]propanoyl}amino)propyl 2-ethylhexanoate |
| 2-(2-ethyl-hexanoyloxy)-propionic acid-[3-(2-ethyl-hexanoyloxy)-propylamide] |