Benzeneacetonitrile, a-[(3-chlorophenyl)methylene]-4-methoxy- structure
|
Common Name | Benzeneacetonitrile, a-[(3-chlorophenyl)methylene]-4-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 7146-74-9 | Molecular Weight | 269.72600 | |
| Density | 1.215g/cm3 | Boiling Point | 418.1ºC at 760 mmHg | |
| Molecular Formula | C16H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | 3-(3-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile |
|---|
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 418.1ºC at 760 mmHg |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.72600 |
| Flash Point | 206.7ºC |
| Exact Mass | 269.06100 |
| PSA | 33.02000 |
| LogP | 4.41278 |
| Index of Refraction | 1.624 |
| InChIKey | CQJMTOOEWQBWPO-NTEUORMPSA-N |
| SMILES | COc1ccc(C(C#N)=Cc2cccc(Cl)c2)cc1 |
|
~%
Benzeneacetonit... CAS#:7146-74-9 |
| Literature: Burckhalter et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 394 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |