2-Propen-1-one,1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)- structure
|
Common Name | 2-Propen-1-one,1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7146-86-3 | Molecular Weight | 254.28100 | |
| Density | 1.197g/cm3 | Boiling Point | 434.5ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 95ºC | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | 2'-hydroxy-3-methoxychalcone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 434.5ºC at 760 mmHg |
| Melting Point | 95ºC |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 162.8ºC |
| Exact Mass | 254.09400 |
| PSA | 46.53000 |
| LogP | 3.29690 |
| Index of Refraction | 1.631 |
| InChIKey | UKFWQYIIRNXCEQ-MDZDMXLPSA-N |
| SMILES | COc1cccc(C=CC(=O)c2ccccc2O)c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| [E]-3-(m-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| 3-methoxy-2'-hydroxychalcone |
| (E)-2'-hydroxy-3-methoxychalcone |
| (E)-1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| 2'-Hydroxy-3-methoxychalcon |
| (2E)-1-(2-hydroxyphenyl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| 2'-HYDROXY-2,4,4',5,6'-PENTAMETHOXYCHALCONE |