(2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid
(2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid structure
|
Common Name | (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 7147-45-7 | Molecular Weight | 258.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H14N2O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H14N2O5S2 |
|---|---|
| Molecular Weight | 258.31600 |
| Exact Mass | 258.03400 |
| PSA | 178.38000 |
| LogP | 1.75450 |
| InChIKey | QITUIJVWQWGNAC-UHFFFAOYSA-N |
| SMILES | N=C(N)SC1CCCC1O.O=S(=O)(O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(2-hydroxycyclo... CAS#:7147-45-7 |
| Literature: Bordwell; Andersen Journal of the American Chemical Society, 1953 , vol. 75, p. 4959,4961 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (+-)-S-(trans-2-Hydroxy-cyclopentyl)-isothioharnstoff,Sulfat |
| (+-)-S-(trans-2-hydroxy-cyclopentyl)-isothiourea,sulfate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: CAS number of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid is 7147-45-7. |
| Q: What is the Chinese name of 7147-45-7? |
| A: Chinese name of 7147-45-7 is 7147-45-7. |
| Q: What is the InChIKey of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: InChIKey of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid is QITUIJVWQWGNAC-UHFFFAOYSA-N. |
| Q: What is the English name of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: The English name of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid is (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid. |
| Q: What are the upstream materials of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: Related upstream materials(CAS) of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid: 285-67-6. |
| Q: What is the LogP of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: LogP of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid is 1.75450. |
| Q: What is the SMILES notation of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: SMILES notation of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid is N=C(N)SC1CCCC1O.O=S(=O)(O)O. |
| Q: What is the molecular formula of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: Molecular formula of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid is C6H14N2O5S2. |
| Q: What is the polar surface area (PSA) of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: Polar surface area (PSA) of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid is 178.38000. |
| Q: What is the molecular weight of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid? |
| A: Molecular weight of (2-hydroxycyclopentyl) carbamimidothioate,sulfuric acid is 258.31600. |