Urea,N-[(3-chlorophenyl)methyl]-N'-(1,1-dimethylethyl)- structure
|
Common Name | Urea,N-[(3-chlorophenyl)methyl]-N'-(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 71475-41-7 | Molecular Weight | 240.72900 | |
| Density | 1.119g/cm3 | Boiling Point | 409.2ºC at 760 mmHg | |
| Molecular Formula | C12H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.3ºC | |
| Name | 1-tert-butyl-3-[(3-chlorophenyl)methyl]urea |
|---|
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 409.2ºC at 760 mmHg |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.72900 |
| Flash Point | 201.3ºC |
| Exact Mass | 240.10300 |
| PSA | 41.13000 |
| LogP | 3.71950 |
| Index of Refraction | 1.529 |
| InChIKey | DBBDLJBJSHSEAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)NCc1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |