1-[4-[2-(4-chlorophenyl)ethenyl]phenyl]-2-dimethylamino-ethanol structure
|
Common Name | 1-[4-[2-(4-chlorophenyl)ethenyl]phenyl]-2-dimethylamino-ethanol | ||
|---|---|---|---|---|
| CAS Number | 7148-00-7 | Molecular Weight | 301.81100 | |
| Density | 1.179g/cm3 | Boiling Point | 457.4ºC at 760 mmHg | |
| Molecular Formula | C18H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.5ºC | |
| Name | 1-[4-[2-(4-chlorophenyl)ethenyl]phenyl]-2-(dimethylamino)ethanol |
|---|
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 457.4ºC at 760 mmHg |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.81100 |
| Flash Point | 230.5ºC |
| Exact Mass | 301.12300 |
| PSA | 23.47000 |
| LogP | 4.10540 |
| Index of Refraction | 1.643 |
| InChIKey | KBGPTRHFMZERIT-ONEGZZNKSA-N |
| SMILES | CN(C)CC(O)c1ccc(C=Cc2ccc(Cl)cc2)cc1 |
|
~%
1-[4-[2-(4-chlo... CAS#:7148-00-7 |
| Literature: Codington; Mosettig Journal of Organic Chemistry, 1952 , vol. 17, p. 1035,1040 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |