4-amino-N-(3-bromo-4-tert-butyl-phenyl)benzenesulfonamide structure
|
Common Name | 4-amino-N-(3-bromo-4-tert-butyl-phenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7148-20-1 | Molecular Weight | 383.30300 | |
| Density | 1.453g/cm3 | Boiling Point | 495.4ºC at 760 mmHg | |
| Molecular Formula | C16H19BrN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.4ºC | |
| Name | 4-Amino-N-(2,5-dimethyl-3-pyrazinyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 495.4ºC at 760 mmHg |
| Molecular Formula | C16H19BrN2O2S |
| Molecular Weight | 383.30300 |
| Flash Point | 253.4ºC |
| Exact Mass | 382.03500 |
| PSA | 80.57000 |
| LogP | 5.86460 |
| Index of Refraction | 1.629 |
| InChIKey | AXPXCXUYLGNCCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(NS(=O)(=O)c2ccc(N)cc2)cc1Br |
|
~%
4-amino-N-(3-br... CAS#:7148-20-1 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1602,1603 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Sulfanilsaeure-(3-brom-4-tert-butyl-anilid) |
| Sulfanilsaeure-(3,6-dimethyl-pyrazin-2-ylamid) |
| sulfanilic acid-(3,6-dimethyl-pyrazin-2-ylamide) |
| sulfanilic acid-(3-bromo-4-tert-butyl-anilide) |