Psicose, 1-deoxy-, 6-benzoate, D- (8CI) structure
|
Common Name | Psicose, 1-deoxy-, 6-benzoate, D- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7148-36-9 | Molecular Weight | 268.26300 | |
| Density | 1.337g/cm3 | Boiling Point | 518.7ºC at 760 mmHg | |
| Molecular Formula | C13H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.8ºC | |
| Name | [(2R,3R,4R)-2,3,4-trihydroxy-5-oxohexyl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 518.7ºC at 760 mmHg |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26300 |
| Flash Point | 198.8ºC |
| Exact Mass | 268.09500 |
| PSA | 104.06000 |
| Index of Refraction | 1.568 |
| InChIKey | RCJORMIDZAKFPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(O)C(O)C(O)COC(=O)c1ccccc1 |
|
~%
Psicose, 1-deox... CAS#:7148-36-9 |
| Literature: Reist,E.J. et al. Journal of Organic Chemistry, 1962 , vol. 27, p. 1722 - 1727 |
| O-(Galactopyranosyluronic acid)-(1-6)glucose |