5-fluoro-2-nitro-fluoren-9-one structure
|
Common Name | 5-fluoro-2-nitro-fluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 7148-56-3 | Molecular Weight | 243.19000 | |
| Density | 1.511g/cm3 | Boiling Point | 430.4ºC at 760 mmHg | |
| Molecular Formula | C13H6FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.1ºC | |
| Name | 5-fluoro-2-nitrofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 430.4ºC at 760 mmHg |
| Molecular Formula | C13H6FNO3 |
| Molecular Weight | 243.19000 |
| Flash Point | 214.1ºC |
| Exact Mass | 243.03300 |
| PSA | 62.89000 |
| LogP | 3.46850 |
| Index of Refraction | 1.675 |
| InChIKey | VNEYMHNYWQBPAG-UHFFFAOYSA-N |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-c2c(F)cccc21 |
|
~%
5-fluoro-2-nitr... CAS#:7148-56-3 |
| Literature: Fletcher,T.L. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 996 - 1000 |
|
~%
5-fluoro-2-nitr... CAS#:7148-56-3 |
| Literature: Fletcher,T.L. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 996 - 1000 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-Fluor-2-nitro-9-oxo-fluoren |
| 5-fluoro-2-nitrofluorenone |
| 5-fluoro-2-nitro-9h-fluoren-9-one |