Ephedradine A dihydrochloride
Modify Date: 2026-07-17 16:08:28
Ephedradine A dihydrochloride structure
|
Common Name | Ephedradine A dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 71484-61-2 | Molecular Weight | 565.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H38Cl2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ephedradine A dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H38Cl2N4O4 |
|---|---|
| Molecular Weight | 565.5 |
| InChIKey | GCBRRNGZQYVRGL-IAWKLPQASA-N |
| SMILES | Cl.Cl.O=C1CC2NCCCNCCCCN(CCCN1)C(=O)C1c3cc2ccc3OC1c1ccc(O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ephedradine A dihydrochloride? |
| A: CAS number of Ephedradine A dihydrochloride is 71484-61-2. |
| Q: What is the molecular weight of Ephedradine A dihydrochloride? |
| A: Molecular weight of Ephedradine A dihydrochloride is 565.5. |
| Q: What is the Chinese name of 71484-61-2? |
| A: Chinese name of 71484-61-2 is 71484-61-2. |
| Q: What is the SMILES notation of Ephedradine A dihydrochloride? |
| A: SMILES notation of Ephedradine A dihydrochloride is Cl.Cl.O=C1CC2NCCCNCCCCN(CCCN1)C(=O)C1c3cc2ccc3OC1c1ccc(O)cc1. |
| Q: What is the molecular formula of Ephedradine A dihydrochloride? |
| A: Molecular formula of Ephedradine A dihydrochloride is C28H38Cl2N4O4. |
| Q: What is the InChIKey of Ephedradine A dihydrochloride? |
| A: InChIKey of Ephedradine A dihydrochloride is GCBRRNGZQYVRGL-IAWKLPQASA-N. |
| Q: What is the English name of Ephedradine A dihydrochloride? |
| A: The English name of Ephedradine A dihydrochloride is Ephedradine A dihydrochloride. |