Benzenesulfonamide,N-[2-chloro-5-(phenylsulfonyl)-4-[(phenylsulfonyl)amino]phenyl]- structure
|
Common Name | Benzenesulfonamide,N-[2-chloro-5-(phenylsulfonyl)-4-[(phenylsulfonyl)amino]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 7149-04-4 | Molecular Weight | 563.06500 | |
| Density | 1.53g/cm3 | Boiling Point | 741.6ºC at 760mmHg | |
| Molecular Formula | C24H19ClN2O6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 402.3ºC | |
| Name | N-[4-(benzenesulfonamido)-5-(benzenesulfonyl)-2-chlorophenyl]benzenesulfonamide |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 741.6ºC at 760mmHg |
| Molecular Formula | C24H19ClN2O6S3 |
| Molecular Weight | 563.06500 |
| Flash Point | 402.3ºC |
| Exact Mass | 562.00900 |
| PSA | 151.62000 |
| LogP | 8.16280 |
| Index of Refraction | 1.682 |
| InChIKey | DDSZSTUPXTWDFK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1cc(S(=O)(=O)c2ccccc2)c(NS(=O)(=O)c2ccccc2)cc1Cl)c1ccccc1 |
|
~%
Benzenesulfonam... CAS#:7149-04-4 |
| Literature: Adams; Young Journal of the American Chemical Society, 1953 , vol. 75, p. 3235,3237 |
|
~%
Benzenesulfonam... CAS#:7149-04-4 |
| Literature: Adams; Young Journal of the American Chemical Society, 1953 , vol. 75, p. 3235,3237 |
|
~%
Benzenesulfonam... CAS#:7149-04-4 |
| Literature: Adams; Young Journal of the American Chemical Society, 1953 , vol. 75, p. 3235,3237 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |