NCGC00063279 structure
|
Common Name | NCGC00063279 | ||
|---|---|---|---|---|
| CAS Number | 714932-54-4 | Molecular Weight | 319.314 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 583.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.4±32.9 °C | |
Use of NCGC00063279NCGC00063279 is a novel inhibitor of the werner syndrome helicase-nuclease (wrn) helicase |
| Name | 6-Methoxy-3-(5-phenyl-1,2,4-oxadiazol-3-yl)-2(1H)-quinolinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 583.0±60.0 °C at 760 mmHg |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.314 |
| Flash Point | 306.4±32.9 °C |
| Exact Mass | 319.095703 |
| LogP | 5.39 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | BRKAIFLXINCNLS-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(=O)c(-c3noc(-c4ccccc4)n3)cc2c1 |
| 2(1H)-Quinolinone, 6-methoxy-3-(5-phenyl-1,2,4-oxadiazol-3-yl)- |
| 6-Methoxy-3-(5-phenyl-1,2,4-oxadiazol-3-yl)-2(1H)-quinolinone |