triethyl isocyanurate
triethyl isocyanurate structure
|
Common Name | triethyl isocyanurate | ||
|---|---|---|---|---|
| CAS Number | 715-63-9 | Molecular Weight | 213.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H15N3O3 |
|---|---|
| Molecular Weight | 213.23400 |
| Exact Mass | 213.11100 |
| PSA | 66.00000 |
| InChIKey | VBIWIGSLGRYEDA-UHFFFAOYSA-N |
| SMILES | CCn1c(=O)n(CC)c(=O)n(CC)c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 2 | |
CAS#:109-90-0
CAS#:64-17-5
CAS#:51-79-6![triethyl-[1,3,5]-triazinetrione triimine Structure](https://image.chemsrc.com/caspic/334/87719-06-0.png)
CAS#:87719-06-0
CAS#:178318-21-3
CAS#:75-03-6
CAS#:590-28-3
CAS#:884-43-5
CAS#:111-36-4
CAS#:121-44-8
CAS#:463-79-6
CAS#:75-04-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-triethyl |
| triethyl isocyanurate |
| 1,3,5-triethyltriazine-2,4,6-trione |
| 1,3,5-triethylisocyanurate |
| 1,3,5-triethyl-[1,3,5]triazinane-2,4,6-trione |
| Triaethyl-[1,3,5]triazintrion |
| Triaethylisocyanursaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: Molecular weight of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione is 213.23400. |
| Q: What is the SMILES notation of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: SMILES notation of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione is CCn1c(=O)n(CC)c(=O)n(CC)c1=O. |
| Q: What is the molecular formula of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: Molecular formula of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione is C9H15N3O3. |
| Q: What English synonyms does 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione have? |
| A: English synonyms of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione: 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-triethyl, triethyl isocyanurate, 1,3,5-triethyltriazine-2,4,6-trione, 1,3,5-triethylisocyanurate, 1,3,5-triethyl-[1,3,5]triazinane-2,4,6-trione, Triaethyl-[1,3,5]triazintrion, Triaethylisocyanursaeure. |
| Q: What is the English name of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: The English name of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione is 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione. |
| Q: What is the polar surface area (PSA) of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: Polar surface area (PSA) of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione is 66.00000. |
| Q: What are the upstream materials of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: Related upstream materials(CAS) of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione: 109-90-0;64-17-5;51-79-6;87719-06-0;178318-21-3;75-03-6;590-28-3;884-43-5;111-36-4;121-44-8. |
| Q: What is the InChIKey of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: InChIKey of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione is VBIWIGSLGRYEDA-UHFFFAOYSA-N. |
| Q: What are the downstream products of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: Related downstream products(CAS) of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione: 463-79-6;75-04-7. |
| Q: What is the CAS number of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione? |
| A: CAS number of 1,3,5-triethyl-1,3,5-triazinane-2,4,6-trione is 715-63-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |