2,4(1H,3H)-Pyrimidinedione,6-amino-5-bromo-1,3-dimethyl
2,4(1H,3H)-Pyrimidinedione,6-amino-5-bromo-1,3-dimethyl structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-amino-5-bromo-1,3-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 7150-04-1 | Molecular Weight | 234.051 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 246.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C6H8BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.7±30.1 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 246.3±50.0 °C at 760 mmHg |
| Molecular Formula | C6H8BrN3O2 |
| Molecular Weight | 234.051 |
| Flash Point | 102.7±30.1 °C |
| Exact Mass | 232.979980 |
| PSA | 70.02000 |
| LogP | 0.08 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | NTGBQOXQWAQTLU-UHFFFAOYSA-N |
| SMILES | Cn1c(N)c(Br)c(=O)n(C)c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4(1H,3H)-Pyri... CAS#:7150-04-1 |
| Literature: Monsanto Chem.Co. Patent: US2827461 , 1955 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
CAS#:58-08-2![Pyrimido[5,4-g]pteridine-2,4,6,8(1H,3H,7H,9H)-tetrone,1,3,7,9-tetramethyl structure](https://image.chemsrc.com/caspic/215/6439-85-6.png)
CAS#:6439-85-6![1,3,6,8-tetramethylpyrimido[4,5-g]pteridine-2,4,7,9-tetrone structure](https://image.chemsrc.com/caspic/381/7464-89-3.png)
CAS#:7464-89-3This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Amino-5-brom-1,3-dimethyl-1H-pyrimidin-2,4-dion |
| 6-Amino-5-bromo-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione |
| 6-amino-5-bromo-1,3-dimethyl-1H-pyrimidine-2,4-dione |
| 6-Amino-5-bromo-1,3-dimethylpyrimidine-2,4(1H,3H)-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: Boiling point of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione is 246.3±50.0 °C at 760 mmHg. |
| Q: What is the English name of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: The English name of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione is 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione. |
| Q: What are the upstream materials of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: Related upstream materials(CAS) of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione: 6642-31-5. |
| Q: What is the molecular weight of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: Molecular weight of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione is 234.051. |
| Q: What English synonyms does 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione have? |
| A: English synonyms of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione: 6-Amino-5-brom-1,3-dimethyl-1H-pyrimidin-2,4-dion, 6-Amino-5-bromo-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione, 6-amino-5-bromo-1,3-dimethyl-1H-pyrimidine-2,4-dione, 6-Amino-5-bromo-1,3-dimethylpyrimidine-2,4(1H,3H)-dione. |
| Q: What is the SMILES notation of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: SMILES notation of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione is Cn1c(N)c(Br)c(=O)n(C)c1=O. |
| Q: What is the InChIKey of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: InChIKey of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione is NTGBQOXQWAQTLU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: CAS number of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione is 7150-04-1. |
| Q: What is the polar surface area (PSA) of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: Polar surface area (PSA) of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione is 70.02000. |
| Q: What is the LogP of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione? |
| A: LogP of 6-amino-5-bromo-1,3-dimethylpyrimidine-2,4-dione is 0.08. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |