2-(2,5-dimethyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)ethyl-trimethyl-azanium structure
|
Common Name | 2-(2,5-dimethyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl)ethyl-trimethyl-azanium | ||
|---|---|---|---|---|
| CAS Number | 7150-85-8 | Molecular Weight | 365.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H30IN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,5-dimethyl-1,3,3a,4,7,7a-hexahydroisoindol-2-ium-2-yl)ethyl-trimethylazanium,iodide |
|---|
| Molecular Formula | C15H30IN2+ |
|---|---|
| Molecular Weight | 365.31700 |
| Exact Mass | 365.14500 |
| InChIKey | IYTOYWMITOEFCK-UHFFFAOYSA-M |
| SMILES | CC1=CCC2C[N+](C)(CC[N+](C)(C)C)CC2C1.[I-] |
|
~%
2-(2,5-dimethyl... CAS#:7150-85-8 |
| Literature: Rice et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4911,4914 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |