N,N,2-trimethylquinolin-6-amine, compound with iodomethane (1:1) structure
|
Common Name | N,N,2-trimethylquinolin-6-amine, compound with iodomethane (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71501-20-7 | Molecular Weight | 328.19200 | |
| Density | N/A | Boiling Point | 400.2ºC at 760 mmHg | |
| Molecular Formula | C13H17IN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | iodomethane,N,N,2-trimethylquinolin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 400.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.19200 |
| Flash Point | 195.8ºC |
| Exact Mass | 328.04400 |
| PSA | 16.13000 |
| LogP | 3.66040 |
| InChIKey | HPPIBEXSFJHGSC-UHFFFAOYSA-N |
| SMILES | CI.Cc1ccc2cc(N(C)C)ccc2n1 |
| EINECS 275-551-5 |
| N,N,2-Trimethylquinolin-6-amine,compound with iodomethane (1:1) |