4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one
4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one structure
|
Common Name | 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one | ||
|---|---|---|---|---|
| CAS Number | 71505-81-2 | Molecular Weight | 328.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24O4 |
|---|---|
| Molecular Weight | 328.40200 |
| Exact Mass | 328.16700 |
| PSA | 55.76000 |
| LogP | 3.19920 |
| InChIKey | JVVFSNSDYQQXJB-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCC(=O)C(O)CCc2cccc(OC)c2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Hydroxy-1,6-bis-(m-methoxyphenyl)-hexan-3-on |
| 3-Hexanone,4-hydroxy-1,6-bis(3-methoxyphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 71505-81-2? |
| A: Chinese name of 71505-81-2 is 71505-81-2. |
| Q: What is the molecular weight of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one? |
| A: Molecular weight of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one is 328.40200. |
| Q: What English synonyms does 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one have? |
| A: English synonyms of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one: 4-Hydroxy-1,6-bis-(m-methoxyphenyl)-hexan-3-on, 3-Hexanone,4-hydroxy-1,6-bis(3-methoxyphenyl). |
| Q: What is the SMILES notation of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one? |
| A: SMILES notation of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one is COc1cccc(CCC(=O)C(O)CCc2cccc(OC)c2)c1. |
| Q: What are the upstream materials of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one? |
| A: Related upstream materials(CAS) of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one: 50704-52-4;40138-66-7;6099-04-3;10516-71-9;7252-82-6. |
| Q: What is the molecular formula of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one? |
| A: Molecular formula of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one is C20H24O4. |
| Q: What is the polar surface area (PSA) of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one? |
| A: Polar surface area (PSA) of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one is 55.76000. |
| Q: What is the InChIKey of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one? |
| A: InChIKey of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one is JVVFSNSDYQQXJB-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one? |
| A: LogP of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one is 3.19920. |
| Q: What is the English name of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one? |
| A: The English name of 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one is 4-hydroxy-1,6-bis(3-methoxyphenyl)hexan-3-one. |