2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methyl-quinoline
2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methyl-quinoline structure
|
Common Name | 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methyl-quinoline | ||
|---|---|---|---|---|
| CAS Number | 71509-00-7 | Molecular Weight | 267.32600 | |
| Density | 1.17g/cm3 | Boiling Point | 443ºC at 760 mmHg | |
| Molecular Formula | C16H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 443ºC at 760 mmHg |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.32600 |
| Flash Point | 221.7ºC |
| Exact Mass | 267.13700 |
| PSA | 39.94000 |
| LogP | 3.35430 |
| Index of Refraction | 1.613 |
| InChIKey | INKWUKDNGQHKRV-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(-n3nc(C)cc3C)cc(C)c2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~6%
2-(3,5-dimethyl... CAS#:71509-00-7 |
| Literature: Singh, S. P.; Vaid, R. K.; Prakash, I.; Prakash, O. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 945 - 950 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Quinoline,2-(3,5-dimethyl-1H-pyrazol-1-yl)-6-methoxy-4-methyl |
| 2-(3,5-Dimethyl-1H-pyrazol-1-yl)-6-methoxy-4-methylquinoline |
| 2-(3',5'-Dimethylpyrazol-1'-yl)-4-methyl-6-methoxyquinoline |
| 2-(3,5-DIMETHYLPYRAZOL-1-YL)-6-METHOXY-4-METHYL-QUINOLINE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: SMILES notation of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline is COc1ccc2nc(-n3nc(C)cc3C)cc(C)c2c1. |
| Q: What is the polar surface area (PSA) of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: Polar surface area (PSA) of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline is 39.94000. |
| Q: What is the boiling point of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: Boiling point of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline is 443ºC at 760 mmHg. |
| Q: What is the CAS number of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: CAS number of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline is 71509-00-7. |
| Q: What is the LogP of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: LogP of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline is 3.35430. |
| Q: What are the upstream materials of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: Related upstream materials(CAS) of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline: 67-51-6;6340-55-2. |
| Q: What is the Chinese name of 71509-00-7? |
| A: Chinese name of 71509-00-7 is 71509-00-7. |
| Q: What is the English name of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: The English name of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline is 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline. |
| Q: What is the molecular weight of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: Molecular weight of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline is 267.32600. |
| Q: What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline? |
| A: InChIKey of 2-(3,5-dimethylpyrazol-1-yl)-6-methoxy-4-methylquinoline is INKWUKDNGQHKRV-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |