Acetamide,N-[4-[[(methylamino)carbonyl]amino]phenyl]
![Acetamide,N-[4-[[(methylamino)carbonyl]amino]phenyl] Structure](https://image.chemsrc.com/caspic/247/7151-79-3.png)
Acetamide,N-[4-[[(methylamino)carbonyl]amino]phenyl] structure
|
Common Name | Acetamide,N-[4-[[(methylamino)carbonyl]amino]phenyl] | ||
|---|---|---|---|---|
| CAS Number | 7151-79-3 | Molecular Weight | 207.22900 | |
| Density | 1.26g/cm3 | Boiling Point | 402.8ºC at 760mmHg | |
| Molecular Formula | C10H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Methyl-N'-(4-acetamino-phenyl)-harnstoff |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 402.8ºC at 760mmHg |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.22900 |
| Flash Point | 173ºC |
| Exact Mass | 207.10100 |
| PSA | 70.23000 |
| LogP | 1.93320 |
| Index of Refraction | 1.628 |
| InChIKey | DNBNPZMPGGMHEP-UHFFFAOYSA-N |
| SMILES | CNC(=O)Nc1ccc(NC(C)=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Acetamide,N-[4-... CAS#:7151-79-3 |
| Literature: Johnston,T.P. et al. J. Med. Chem., 1963 , vol. 6, p. 669 - 681 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: LogP of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff is 1.93320. |
| Q: What is the molecular formula of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: Molecular formula of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff is C10H13N3O2. |
| Q: What is the SMILES notation of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: SMILES notation of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff is CNC(=O)Nc1ccc(NC(C)=O)cc1. |
| Q: What is the Chinese name of 7151-79-3? |
| A: Chinese name of 7151-79-3 is 7151-79-3. |
| Q: What is the English name of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: The English name of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff is N-Methyl-N'-(4-acetamino-phenyl)-harnstoff. |
| Q: What is the CAS number of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: CAS number of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff is 7151-79-3. |
| Q: What are the upstream materials of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: Related upstream materials(CAS) of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff: 624-83-9;122-80-5. |
| Q: What is the InChIKey of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: InChIKey of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff is DNBNPZMPGGMHEP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: Polar surface area (PSA) of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff is 70.23000. |
| Q: What is the molecular weight of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff? |
| A: Molecular weight of N-Methyl-N'-(4-acetamino-phenyl)-harnstoff is 207.22900. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |