5(4H)-Oxazolone, 4-[(4-nitrophenyl)methylene]-2-phenyl structure
|
Common Name | 5(4H)-Oxazolone, 4-[(4-nitrophenyl)methylene]-2-phenyl | ||
|---|---|---|---|---|
| CAS Number | 7152-75-2 | Molecular Weight | 294.26200 | |
| Density | 1.34g/cm3 | Boiling Point | 436.8ºC at 760 mmHg | |
| Molecular Formula | C16H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | 4-[(4-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760 mmHg |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.26200 |
| Flash Point | 218ºC |
| Exact Mass | 294.06400 |
| PSA | 84.48000 |
| LogP | 2.89810 |
| Index of Refraction | 1.648 |
| InChIKey | QRDLKEDMXPGLTP-UVTDQMKNSA-N |
| SMILES | O=C1OC(c2ccccc2)=NC1=Cc1ccc([N+](=O)[O-])cc1 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-(4-nitrobenzylidene)-2-phenyl-5(4H)-oxazolone |
| 4-(4-nitro-benzylidene)-1-phenyl-pyrazolidine-3,5-dione |
| 4-(4-nitrobenzylidene)-2-phenyl-1,3-oxazol-5(4H)-one |
| 4-(p-Nitrobenzyl)pyridine |
| 4-(4-nitrobenzyliden)-1-phenyl-3,5-dioxypyrazolidine |
| 4-(4-nitro-benzylidene)-2-phenyl-4H-oxazol-5-one |