(Z)-2-cyano-3-(cyclohexylcarbamoylamino)prop-2-enamide structure
|
Common Name | (Z)-2-cyano-3-(cyclohexylcarbamoylamino)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 7152-77-4 | Molecular Weight | 236.27000 | |
| Density | 1.22g/cm3 | Boiling Point | 437.7ºC at 760 mmHg | |
| Molecular Formula | C11H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5ºC | |
| Name | (Z)-2-cyano-3-(cyclohexylcarbamoylamino)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 437.7ºC at 760 mmHg |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27000 |
| Flash Point | 218.5ºC |
| Exact Mass | 236.12700 |
| PSA | 108.01000 |
| LogP | 1.99318 |
| Index of Refraction | 1.553 |
| InChIKey | JDXYMZCXDFOUAL-FPLPWBNLSA-N |
| SMILES | N#CC(=CNC(=O)NC1CCCCC1)C(N)=O |
|
~%
(Z)-2-cyano-3-(... CAS#:7152-77-4 |
| Literature: Whitehead; Traverso Journal of the American Chemical Society, 1955 , vol. 77, p. 5872,5875 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Cyan-3-(N'-cyclohexyl-ureido)-acrylsaeure-amid |
| 2-cyano-3-(N'-cyclohexyl-ureido)-acrylic acid amide |