2-[(carboxymethylsulfanyl-phenyl-methyl)amino]benzoic acid structure
|
Common Name | 2-[(carboxymethylsulfanyl-phenyl-methyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 7152-78-5 | Molecular Weight | 317.36000 | |
| Density | 1.413g/cm3 | Boiling Point | 551.6ºC at 760 mmHg | |
| Molecular Formula | C16H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.4ºC | |
| Name | 2-[[carboxymethylsulfanyl(phenyl)methyl]amino]benzoic acid |
|---|
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 551.6ºC at 760 mmHg |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.36000 |
| Flash Point | 287.4ºC |
| Exact Mass | 317.07200 |
| PSA | 111.93000 |
| LogP | 3.38630 |
| Index of Refraction | 1.693 |
| InChIKey | SQHWCKCVJMCALY-UHFFFAOYSA-N |
| SMILES | O=C(O)CSC(Nc1ccccc1C(=O)O)c1ccccc1 |
|
~%
2-[(carboxymeth... CAS#:7152-78-5 |
| Literature: Surrey Journal of the American Chemical Society, 1947 , vol. 69, p. 2911 |
|
~%
2-[(carboxymeth... CAS#:7152-78-5 |
| Literature: Surrey Journal of the American Chemical Society, 1947 , vol. 69, p. 2911 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |