ethyl 2-hydroxy-3-methoxy-5-prop-2-enyl-benzoate
Modify Date: 2025-08-26 11:39:14
ethyl 2-hydroxy-3-methoxy-5-prop-2-enyl-benzoate structure
|
Common Name | ethyl 2-hydroxy-3-methoxy-5-prop-2-enyl-benzoate | ||
|---|---|---|---|---|
| CAS Number | 7152-89-8 | Molecular Weight | 236.26400 | |
| Density | 1.121g/cm3 | Boiling Point | 339ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123ºC | |
| Name | ethyl 2-hydroxy-3-methoxy-5-prop-2-enylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 339ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 123ºC |
| Exact Mass | 236.10500 |
| PSA | 55.76000 |
| LogP | 2.30600 |
| Index of Refraction | 1.53 |
| InChIKey | CXFVGZDWOVGSLW-UHFFFAOYSA-N |
| SMILES | C=CCc1cc(OC)c(O)c(C(=O)OCC)c1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:3507-08-2
CAS#:2134-91-0|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 5-Allyl-2-hydroxy-3-methoxy-benzoesaeure-aethylester |
| ETHYL 2-HYDROXY-3-METHOXY-5-PROP-2-ENYL-BENZOATE |
| Ethyl 5-allyl-3-methoxysalicylate |
| ethyl 5-allyl-2-hydroxy-3-methoxybenzoate |
| 5-allyl-2-hydroxy-3-methoxy-benzoic acid ethyl ester |