beta-Ethyl-4-methoxy-alpha-(4-methoxyphenyl)-benzenepropanol structure
|
Common Name | beta-Ethyl-4-methoxy-alpha-(4-methoxyphenyl)-benzenepropanol | ||
|---|---|---|---|---|
| CAS Number | 71526-43-7 | Molecular Weight | 300.39200 | |
| Density | 1.076g/cm3 | Boiling Point | 444.1ºC at 760 mmHg | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.4ºC | |
| Name | 1-(4-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]butan-1-ol |
|---|
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 444.1ºC at 760 mmHg |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.39200 |
| Flash Point | 222.4ºC |
| Exact Mass | 300.17300 |
| PSA | 38.69000 |
| LogP | 4.00610 |
| Index of Refraction | 1.55 |
| InChIKey | VJAIOYIKUVGYQS-UHFFFAOYSA-N |
| SMILES | CCC(Cc1ccc(OC)cc1)C(O)c1ccc(OC)cc1 |
|
~85%
beta-Ethyl-4-me... CAS#:71526-43-7 |
| Literature: Malik, Mangel S.; Tewari, S. C.; Rastogi, Shri Nivas Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 10 p. 919 - 922 |
|
~%
beta-Ethyl-4-me... CAS#:71526-43-7 |
| Literature: Malik, Mangel S.; Tewari, S. C.; Rastogi, Shri Nivas Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 10 p. 919 - 922 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |