2-ethyl-1,3-bis(4-methoxyphenyl)propane-1,3-dione structure
|
Common Name | 2-ethyl-1,3-bis(4-methoxyphenyl)propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 71526-44-8 | Molecular Weight | 312.36000 | |
| Density | 1.122g/cm3 | Boiling Point | 478.1ºC at 760 mmHg | |
| Molecular Formula | C19H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6ºC | |
| Name | 2-ethyl-1,3-bis(4-methoxyphenyl)propane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 478.1ºC at 760 mmHg |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.36000 |
| Flash Point | 210.6ºC |
| Exact Mass | 312.13600 |
| PSA | 52.60000 |
| LogP | 3.79560 |
| Index of Refraction | 1.548 |
| InChIKey | ADOUYSBKSXTAMH-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)c1ccc(OC)cc1)C(=O)c1ccc(OC)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Ethyl-1,3-bis(4-methoxyphenyl)-1,3-propanedione |
| 2-ethyl-1,3-bis(4-methoxyphenyl)propan-1,3-dion |
| 1,3-bis(4-methoxyphenyl)-2-ethyl-propane-1,3-dione |