Lactic acid, butylester, DL-, DL-2-(2,4,5-trichlorophenoxy)propionate (8CI) structure
|
Common Name | Lactic acid, butylester, DL-, DL-2-(2,4,5-trichlorophenoxy)propionate (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7153-03-9 | Molecular Weight | 397.67800 | |
| Density | 1.301g/cm3 | Boiling Point | 461.3ºC at 760 mmHg | |
| Molecular Formula | C16H19Cl3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162ºC | |
| Name | 2-Oxazolamine,N-(2,3-dihydro-1H-inden-2-yl)-4,5-dihydro |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 461.3ºC at 760 mmHg |
| Molecular Formula | C16H19Cl3O5 |
| Molecular Weight | 397.67800 |
| Flash Point | 162ºC |
| Exact Mass | 396.03000 |
| PSA | 61.83000 |
| LogP | 4.68910 |
| Index of Refraction | 1.519 |
| InChIKey | OWONGIIGDCASQL-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C(C)OC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl |
|
~%
Lactic acid, bu... CAS#:7153-03-9 |
| Literature: Krewson et al. Journal of Agricultural and Food Chemistry, 1959 , vol. 7, p. 118,120 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-[2-(2,4,5-trichloro-phenoxy)-propionyloxy]-propionic acid butyl ester |
| 2-[2-(2,4,5-Trichlor-phenoxy)-propionyloxy]-propionsaeure-butylester |
| 2-Indanamine,N-(2-oxazolin-2-yl) |
| N-(2-Oxazolin-2-yl)-2-indanamine |
| 2-(2-Indanylamino)-2-oxazoline |
| 2-[2-(2,3-dihydro-1H-inden)-amino]-4,5-dihydrooxazole |
| 2-[2-(2,3-dihydro-1H-indene)amino]-4,5-dihydrooxazole |