diethyl 2,3-bis(acetyloxymethyl)-7-oxa-5,6-diazabicyclo[2.2.1]hept-2-ene-5,6-dicarboxylate structure
|
Common Name | diethyl 2,3-bis(acetyloxymethyl)-7-oxa-5,6-diazabicyclo[2.2.1]hept-2-ene-5,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 71539-03-2 | Molecular Weight | 386.35400 | |
| Density | 1.327g/cm3 | Boiling Point | 467.2ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.4ºC | |
| Name | diethyl 5,6-bis(acetyloxymethyl)-7-oxa-2,3-diazabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 467.2ºC at 760 mmHg |
| Molecular Formula | C16H22N2O9 |
| Molecular Weight | 386.35400 |
| Flash Point | 236.4ºC |
| Exact Mass | 386.13300 |
| PSA | 120.91000 |
| LogP | 0.81300 |
| Index of Refraction | 1.512 |
| InChIKey | PUAQFRJKONMVPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C2OC(C(COC(C)=O)=C2COC(C)=O)N1C(=O)OCC |
|
~%
diethyl 2,3-bis... CAS#:71539-03-2 |
| Literature: Anderson; Dewey; Mulumba Journal of Medicinal Chemistry, 1979 , vol. 22, # 10 p. 1270 - 1272 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |