[acetyloxy-(4-propan-2-ylphenyl)methyl] acetate structure
|
Common Name | [acetyloxy-(4-propan-2-ylphenyl)methyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 7154-10-1 | Molecular Weight | 250.29000 | |
| Density | 1.09g/cm3 | Boiling Point | 278.5ºC at 760 mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.4ºC | |
| Name | 4-isopropylbenzal diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 278.5ºC at 760 mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29000 |
| Flash Point | 114.4ºC |
| Exact Mass | 250.12100 |
| PSA | 52.60000 |
| LogP | 2.93480 |
| Index of Refraction | 1.499 |
| InChIKey | MLSOUBLMNULAPA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(OC(C)=O)c1ccc(C(C)C)cc1 |
|
~95%
[acetyloxy-(4-p... CAS#:7154-10-1 |
| Literature: Karimi, Babak; Maleki, Jafar Journal of Organic Chemistry, 2003 , vol. 68, # 12 p. 4951 - 4954 |
|
~%
[acetyloxy-(4-p... CAS#:7154-10-1 |
| Literature: Sieveking Justus Liebigs Annalen der Chemie, 1858 , vol. 106, p. 258 |
| p-isopropylazobenzene |
| 1-diacetoxymethyl-4-isopropyl-benzene |
| 4-Isopropyl-azobenzol |
| 1-Diacetoxymethyl-4-isopropyl-benzol |
| Cuminal-diacetat |