N-benzoyl-3-methoxy-benzohydrazide structure
|
Common Name | N-benzoyl-3-methoxy-benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 7154-74-7 | Molecular Weight | 270.28300 | |
| Density | 1.217g/cm3 | Boiling Point | 530ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.3ºC | |
| Name | 3-methoxy-benzoic acid N'-benzoyl-hydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 530ºC at 760 mmHg |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.28300 |
| Flash Point | 274.3ºC |
| Exact Mass | 270.10000 |
| PSA | 67.43000 |
| LogP | 2.55180 |
| Index of Refraction | 1.591 |
| InChIKey | QTNSAFOKEVLPEO-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)NNC(=O)c2ccccc2)c1 |
| HS Code | 2928000090 |
|---|
|
~50%
N-benzoyl-3-met... CAS#:7154-74-7 |
| Literature: Jacobsen, Noel W.; Philippides, Athena E. Australian Journal of Chemistry, 1986 , vol. 39, # 11 p. 1911 - 1914 |
|
~11%
N-benzoyl-3-met... CAS#:7154-74-7 |
| Literature: Cesarini, Sara; Colombo, Nicoletta; Pulici, Maurizio; Felder, Eduard R.; Brill, Wolfgang K.-D. Tetrahedron, 2006 , vol. 62, # 43 p. 10223 - 10236 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-Benzoyl-2-<3-methoxy-benzoyl>-hydrazin |
| 3-anisoyl chloride |
| 3-methoxybenzoic acid chloride |
| N'-benzoyl-3-methoxybenzohydrazide |
| m-Anisoyl chloride |
| Benzoyl chloride,3-methoxy |
| m-anisic acid chloride |
| m-Methoxybenzoyl chloride |