ethyl 2-[2-[(4-chlorophenyl)methyl]phenoxy]acetate structure
|
Common Name | ethyl 2-[2-[(4-chlorophenyl)methyl]phenoxy]acetate | ||
|---|---|---|---|---|
| CAS Number | 71549-05-8 | Molecular Weight | 304.76800 | |
| Density | 1.182g/cm3 | Boiling Point | 398.9ºC at 760 mmHg | |
| Molecular Formula | C17H17ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.3ºC | |
| Name | ethyl 2-[2-[(4-chlorophenyl)methyl]phenoxy]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 398.9ºC at 760 mmHg |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.76800 |
| Flash Point | 147.3ºC |
| Exact Mass | 304.08700 |
| PSA | 35.53000 |
| LogP | 3.87270 |
| Index of Refraction | 1.555 |
| InChIKey | SXYMAGONWZFLSP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1ccccc1Cc1ccc(Cl)cc1 |
|
~%
ethyl 2-[2-[(4-... CAS#:71549-05-8 |
| Literature: Wheatley et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 4443 |
|
~%
ethyl 2-[2-[(4-... CAS#:71549-05-8 |
| Literature: Thiele; Ahmed; Jahn; Adrian Arzneimittel-Forschung, 1979 , vol. 29, # 5 p. 711 - 720 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Acetic acid,(2-((4-chlorophenyl)methyl)phenoxy)-,ethyl ester |
| 2-(2-(4-Chlorobenzyl)phenoxy)acetic acid ethyl ester |
| [2-(4-chloro-benzyl)-phenoxy]-acetic acid ethyl ester |
| [2-(4-Chlor-benzyl)-phenoxy]-essigsaeure-aethylester |
| ACETIC ACID,2-(2-(4-CHLOROBENZYL)PHENOXY)-,ETHYL ESTER |
| Sgd 14-74 |
| Ethyl 2-(2-(4-chlorobenzyl)phenoxy)acetate |