4-chloro-3-[4,5-dihydro-3-methyl-5-oxo-4-(phenylazo)-1H-pyrazol-1-yl]benzenesulphonic acid, compound with butylamine (1:1) structure
|
Common Name | 4-chloro-3-[4,5-dihydro-3-methyl-5-oxo-4-(phenylazo)-1H-pyrazol-1-yl]benzenesulphonic acid, compound with butylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71566-56-8 | Molecular Weight | 465.95400 | |
| Density | N/A | Boiling Point | 683.5ºC at 760 mmHg | |
| Molecular Formula | C20H24ClN5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.2ºC | |
| Name | butan-1-amine,4-chloro-3-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonic acid |
|---|
| Boiling Point | 683.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H24ClN5O4S |
| Molecular Weight | 465.95400 |
| Flash Point | 367.2ºC |
| Exact Mass | 465.12400 |
| PSA | 146.16000 |
| LogP | 5.48860 |
| InChIKey | DDDRBDQIUDLUEI-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2cc(S(=O)(=O)O)ccc2Cl)C(=O)C1N=Nc1ccccc1.CCCCN |