1,2-Benzenediol,4-amino-, 1,2-diacetate structure
|
Common Name | 1,2-Benzenediol,4-amino-, 1,2-diacetate | ||
|---|---|---|---|---|
| CAS Number | 71573-24-5 | Molecular Weight | 209.19900 | |
| Density | 1.252g/cm3 | Boiling Point | 364.4ºC at 760mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1ºC | |
| Name | (2-acetyloxy-4-aminophenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 364.4ºC at 760mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 189.1ºC |
| Exact Mass | 209.06900 |
| PSA | 78.62000 |
| LogP | 1.70060 |
| Index of Refraction | 1.549 |
| InChIKey | JPBLUIHWOVGRCD-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(N)cc1OC(C)=O |
|
~98%
1,2-Benzenediol... CAS#:71573-24-5 |
| Literature: Capelli, Luigia; Manini, Paola; Pezzella, Alessandro; Napolitano, Alessandra; D'Ischia, Marco Journal of Organic Chemistry, 2009 , vol. 74, # 18 p. 7191 - 7194 |
|
~%
1,2-Benzenediol... CAS#:71573-24-5 |
| Literature: Balaban Journal of the Chemical Society, 1929 , p. 1092 |
| 4-aminobenzene-1,2-diyl diacetate |
| 4-Amino-brenzcatechin-diacetat |
| 3,4-Diacetoxyanilin |
| 4-amino-1,2-benzenediol diacetate |
| 4-aminobenzene-1,2-diol diacetate |
| 3,4-diacetoxy-aniline |