6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene
6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene structure
|
Common Name | 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene | ||
|---|---|---|---|---|
| CAS Number | 71585-45-0 | Molecular Weight | 244.28600 | |
| Density | 1.091g/cm3 | Boiling Point | 346ºC at 760 mmHg | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 346ºC at 760 mmHg |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.28600 |
| Flash Point | 116.4ºC |
| Exact Mass | 244.11000 |
| PSA | 27.69000 |
| LogP | 2.89140 |
| Index of Refraction | 1.532 |
| InChIKey | WYJFKSQXAMFYCA-UHFFFAOYSA-N |
| SMILES | C#CCOc1cc2c(cc1OC)C=CC(C)(C)O2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-methoxy-2,2-d... CAS#:71585-45-0 |
| Literature: Timar, Tibor; Jaszberenyi, J. Csaba; Hosztafi, Sandor Acta Chimica Hungarica, 1989 , vol. 126, # 2 p. 149 - 156 |
|
~%
6-methoxy-2,2-d... CAS#:71585-45-0 |
| Literature: Timar, Tibor; Jaszberenyi, J. Csaba; Hosztafi, Sandor Acta Chimica Hungarica, 1989 , vol. 126, # 2 p. 149 - 156 |
|
~%
6-methoxy-2,2-d... CAS#:71585-45-0 |
| Literature: Timar, Tibor; Jaszberenyi, J. Csaba; Hosztafi, Sandor Acta Chimica Hungarica, 1989 , vol. 126, # 2 p. 149 - 156 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-METHOXY-2,2-DIMETHYL-7-(2-PROPYNYLOXY)-2H-1-BENZOPYRAN |
| 7-O-propargyl-6-methoxy-2,2-dimethylchromene |
| 2H-1-Benzopyran,6-methoxy-2,2-dimethyl-7-(2-propynyloxy)-(9CI) |
| 2H-1-Benzopyran,6-methoxy-2,2-dimethyl-7-(2-propynyloxy) |
| 2H-1-Benzopyran,6-methoxy-2,2-dimethyl-7-(2-propyn-1-yloxy) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene have? |
| A: English synonyms of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene: 6-METHOXY-2,2-DIMETHYL-7-(2-PROPYNYLOXY)-2H-1-BENZOPYRAN, 7-O-propargyl-6-methoxy-2,2-dimethylchromene, 2H-1-Benzopyran,6-methoxy-2,2-dimethyl-7-(2-propynyloxy)-(9CI), 2H-1-Benzopyran,6-methoxy-2,2-dimethyl-7-(2-propynyloxy), 2H-1-Benzopyran,6-methoxy-2,2-dimethyl-7-(2-propyn-1-yloxy). |
| Q: What is the boiling point of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: Boiling point of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene is 346ºC at 760 mmHg. |
| Q: What is the SMILES notation of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: SMILES notation of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene is C#CCOc1cc2c(cc1OC)C=CC(C)(C)O2. |
| Q: What is the LogP of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: LogP of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene is 2.89140. |
| Q: What is the molecular formula of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: Molecular formula of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene is C15H16O3. |
| Q: What is the English name of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: The English name of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene is 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene. |
| Q: What is the CAS number of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: CAS number of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene is 71585-45-0. |
| Q: What is the polar surface area (PSA) of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: Polar surface area (PSA) of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene is 27.69000. |
| Q: What is the molecular weight of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: Molecular weight of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene is 244.28600. |
| Q: What are the upstream materials of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene? |
| A: Related upstream materials(CAS) of 6-methoxy-2,2-dimethyl-7-prop-2-ynoxychromene: 76348-95-3;125627-90-9. |