benzyl 2-cyclohexyl-2-hydroxyethanoate
benzyl 2-cyclohexyl-2-hydroxyethanoate structure
|
Common Name | benzyl 2-cyclohexyl-2-hydroxyethanoate | ||
|---|---|---|---|---|
| CAS Number | 716362-15-1 | Molecular Weight | 248.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Benzyl 2-cyclohexyl-2-hydroxyethanoate (CAS: 716362-15-1, molecular formula: C15H20O3, molecular weight: 248.31700), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 2-cyclohexyl-2-hydroxyethanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20O3 |
|---|---|
| Molecular Weight | 248.31700 |
| Exact Mass | 248.14100 |
| PSA | 46.53000 |
| LogP | 2.67100 |
| InChIKey | SSPIFGIISLWFRK-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)C(O)C1CCCCC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4354-49-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzyl 2-cyclohexyl-2-hydroxyacetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of benzyl 2-cyclohexyl-2-hydroxyethanoate? |
| A: Related downstream products(CAS) of benzyl 2-cyclohexyl-2-hydroxyethanoate: 4354-49-8. |
| Q: What is the Chinese name of 716362-15-1? |
| A: Chinese name of 716362-15-1 is 716362-15-1. |
| Q: What is the SMILES notation of benzyl 2-cyclohexyl-2-hydroxyethanoate? |
| A: SMILES notation of benzyl 2-cyclohexyl-2-hydroxyethanoate is O=C(OCc1ccccc1)C(O)C1CCCCC1. |
| Q: What is the English name of benzyl 2-cyclohexyl-2-hydroxyethanoate? |
| A: The English name of benzyl 2-cyclohexyl-2-hydroxyethanoate is benzyl 2-cyclohexyl-2-hydroxyethanoate. |
| Q: What is the CAS number of benzyl 2-cyclohexyl-2-hydroxyethanoate? |
| A: CAS number of benzyl 2-cyclohexyl-2-hydroxyethanoate is 716362-15-1. |
| Q: What is the molecular formula of benzyl 2-cyclohexyl-2-hydroxyethanoate? |
| A: Molecular formula of benzyl 2-cyclohexyl-2-hydroxyethanoate is C15H20O3. |
| Q: What is the molecular weight of benzyl 2-cyclohexyl-2-hydroxyethanoate? |
| A: Molecular weight of benzyl 2-cyclohexyl-2-hydroxyethanoate is 248.31700. |
| Q: What is the InChIKey of benzyl 2-cyclohexyl-2-hydroxyethanoate? |
| A: InChIKey of benzyl 2-cyclohexyl-2-hydroxyethanoate is SSPIFGIISLWFRK-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of benzyl 2-cyclohexyl-2-hydroxyethanoate? |
| A: Polar surface area (PSA) of benzyl 2-cyclohexyl-2-hydroxyethanoate is 46.53000. |
| Q: What English synonyms does benzyl 2-cyclohexyl-2-hydroxyethanoate have? |
| A: English synonyms of benzyl 2-cyclohexyl-2-hydroxyethanoate: benzyl 2-cyclohexyl-2-hydroxyacetate. |