methyl 3-(1-nitrocyclohexyl)propanoate structure
|
Common Name | methyl 3-(1-nitrocyclohexyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 71648-41-4 | Molecular Weight | 215.24600 | |
| Density | 1.12g/cm3 | Boiling Point | 299.3ºC at 760 mmHg | |
| Molecular Formula | C10H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.6ºC | |
| Name | methyl 3-(1-nitrocyclohexyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 299.3ºC at 760 mmHg |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.24600 |
| Flash Point | 120.6ºC |
| Exact Mass | 215.11600 |
| PSA | 72.12000 |
| LogP | 2.44240 |
| Index of Refraction | 1.478 |
| InChIKey | AVXYQXCOTAFKQF-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1([N+](=O)[O-])CCCCC1 |
|
~99%
methyl 3-(1-nit... CAS#:71648-41-4 |
| Literature: Kisanga, Philip B.; Ilankumaran, Palanichamy; Fetterly, Brandon M.; Verkade, John G. Journal of Organic Chemistry, 2002 , vol. 67, # 11 p. 3555 - 3560 |
| 3-(1-nitro-cyclohexyl)-propionic acid methyl ester |
| methyl 1-nitrocyclohexanepropionate |
| 1-(2-methoxycarbonylethyl)-1-nitrocyclohexane |
| 3-(1-Nitro-cyclohexyl)-propionsaeure-methylester |
| Cyclohexanepropionic acid,1-nitro-,methyl ester |