N-[2-methyl-4-[[3-methyl-4-(3-oxobutanoylamino)phenyl]methyl]phenyl]-3-oxo-butanamide
![N-[2-methyl-4-[[3-methyl-4-(3-oxobutanoylamino)phenyl]methyl]phenyl]-3-oxo-butanamide Structure](https://image.chemsrc.com/caspic/099/71655-97-5.png)
N-[2-methyl-4-[[3-methyl-4-(3-oxobutanoylamino)phenyl]methyl]phenyl]-3-oxo-butanamide structure
|
Common Name | N-[2-methyl-4-[[3-methyl-4-(3-oxobutanoylamino)phenyl]methyl]phenyl]-3-oxo-butanamide | ||
|---|---|---|---|---|
| CAS Number | 71655-97-5 | Molecular Weight | 394.46400 | |
| Density | 1.203g/cm3 | Boiling Point | 631.6ºC at 760 mmHg | |
| Molecular Formula | C23H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 631.6ºC at 760 mmHg |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.46400 |
| Flash Point | 200.9ºC |
| Exact Mass | 394.18900 |
| PSA | 92.34000 |
| LogP | 3.87540 |
| Index of Refraction | 1.601 |
| InChIKey | WHQUILGEBQKNOH-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1ccc(Cc2ccc(NC(=O)CC(C)=O)c(C)c2)cc1C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-[2-methyl-4-[... CAS#:71655-97-5 |
| Literature: Chem.Fabr.Griesheim-Elektron Patent: DE419813 ; Full Text Show Details Chem.Fabr.Griesheim-Elektron Patent: DE391984 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, 14,1010; 15,205 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4.4'-Bis-acetamino-triphenylcarbinol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan have? |
| A: English synonyms of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan: 4.4'-Bis-acetamino-triphenylcarbinol. |
| Q: What is the LogP of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan? |
| A: LogP of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan is 3.87540. |
| Q: What is the Chinese name of 71655-97-5? |
| A: Chinese name of 71655-97-5 is 71655-97-5. |
| Q: What is the molecular weight of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan? |
| A: Molecular weight of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan is 394.46400. |
| Q: What is the English name of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan? |
| A: The English name of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan is 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan. |
| Q: What is the molecular formula of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan? |
| A: Molecular formula of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan is C23H26N2O4. |
| Q: What is the boiling point of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan? |
| A: Boiling point of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan is 631.6ºC at 760 mmHg. |
| Q: What is the InChIKey of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan? |
| A: InChIKey of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan is WHQUILGEBQKNOH-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan? |
| A: Polar surface area (PSA) of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan is 92.34000. |
| Q: What are the upstream materials of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan? |
| A: Related upstream materials(CAS) of 4.4'-Bis-acetoacetylamino-3.3'-dimethyl-diphenylmethan: 141-97-9;838-88-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |