[2-(hexanoyloxymethyl)-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-3-propoxypropyl] heptanoate structure
|
Common Name | [2-(hexanoyloxymethyl)-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-3-propoxypropyl] heptanoate | ||
|---|---|---|---|---|
| CAS Number | 71662-48-1 | Molecular Weight | 506.67000 | |
| Density | 1.077g/cm3 | Boiling Point | 609.8ºC at 760 mmHg | |
| Molecular Formula | C26H50O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | [2-(hexanoyloxymethyl)-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-3-propoxypropyl] heptanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 609.8ºC at 760 mmHg |
| Molecular Formula | C26H50O9 |
| Molecular Weight | 506.67000 |
| Flash Point | 187.8ºC |
| Exact Mass | 506.34500 |
| PSA | 131.75000 |
| LogP | 3.01640 |
| Index of Refraction | 1.482 |
| InChIKey | VKWOBBQQDHLKIK-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)OCC(COCCC)(COCC(CO)(CO)CO)COC(=O)CCCCC |
| Heptanoic acid mixed esters with dipentaerythritol and 2-ethylhexanoic acid |
| Dipentaerythritol ester of 2-ethylhexanoic and heptanoic acids |