1,5,5-trichloro-7-oxabicyclo[4.1.0]heptane-6-carboxamide structure
|
Common Name | 1,5,5-trichloro-7-oxabicyclo[4.1.0]heptane-6-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 71672-80-5 | Molecular Weight | 244.50300 | |
| Density | 1.62g/cm3 | Boiling Point | 441.8ºC at 760 mmHg | |
| Molecular Formula | C7H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221ºC | |
| Name | 1,5,5-trichloro-7-oxabicyclo[4.1.0]heptane-6-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 441.8ºC at 760 mmHg |
| Molecular Formula | C7H8Cl3NO2 |
| Molecular Weight | 244.50300 |
| Flash Point | 221ºC |
| Exact Mass | 242.96200 |
| PSA | 55.62000 |
| LogP | 2.23390 |
| Index of Refraction | 1.585 |
| InChIKey | RJDOGZFPFXYFDM-UHFFFAOYSA-N |
| SMILES | NC(=O)C12OC1(Cl)CCCC2(Cl)Cl |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2,6-trichloro-7-oxabicyclo[4.1.0]heptane-1-carboxamide |
| 2,6,6-Trichlor-1,2-epoxy-cyclohexancarbonsaeure-amid |
| 2,2,6-trichloro-1,6-epoxy-cyclohexanecarboxylic acid amide |