4-amino-N-(2,5-dichloropentyl)-5-(ethylsulphonyl)-2-methoxybenzamide structure
|
Common Name | 4-amino-N-(2,5-dichloropentyl)-5-(ethylsulphonyl)-2-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 71676-04-5 | Molecular Weight | 397.31700 | |
| Density | 1.309g/cm3 | Boiling Point | 587.2ºC at 760 mmHg | |
| Molecular Formula | C15H22Cl2N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.9ºC | |
| Name | 4-amino-N-(2,5-dichloropentyl)-5-ethylsulfonyl-2-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 587.2ºC at 760 mmHg |
| Molecular Formula | C15H22Cl2N2O4S |
| Molecular Weight | 397.31700 |
| Flash Point | 308.9ºC |
| Exact Mass | 396.06800 |
| PSA | 110.36000 |
| LogP | 4.66400 |
| Index of Refraction | 1.545 |
| InChIKey | PFXOJRCOFMOPTK-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)c1cc(C(=O)NCC(Cl)CCCCl)c(OC)cc1N |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzamide,4-amino-N-(2,5-dichloropentyl)-5-(ethylsulfonyl)-2-methoxy |
| N-(2,5-dichloropentyl) 2-methoxy 4-amino 5-ethylsulphonyl benzamide |
| 4-Amino-N-(2,5-dichloropentyl)-5-(ethylsulphonyl)-2-methoxybenzamide |
| EINECS 275-835-9 |
| 4-AMINO-N-(2,5-DICHLOROPENTYL)-5-(ETHYLSULFONYL)-2-METHOXYBENZAMIDE |