dinitrophenol, compound with 4,5-dihydro-2-methyl-1H-imidazole (1:1) structure
|
Common Name | dinitrophenol, compound with 4,5-dihydro-2-methyl-1H-imidazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71686-05-0 | Molecular Weight | 268.22600 | |
| Density | N/A | Boiling Point | 494.3ºC at 760 mmHg | |
| Molecular Formula | C10H12N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8ºC | |
| Name | 2,3-dinitrophenol,2-methyl-4,5-dihydro-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 494.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.22600 |
| Flash Point | 252.8ºC |
| Exact Mass | 268.08100 |
| PSA | 136.26000 |
| LogP | 2.02740 |
| InChIKey | WSDALBIAWSCTQQ-UHFFFAOYSA-N |
| SMILES | CC1=NCCN1.O=[N+]([O-])c1cccc(O)c1[N+](=O)[O-] |
| EINECS 275-847-4 |
| Dinitrophenol,compound with 4,5-dihydro-2-methyl-1H-imidazole (1:1) |