Methyl 3-bromo-4-(dimethylamino)benzoate structure
|
Common Name | Methyl 3-bromo-4-(dimethylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 71695-21-1 | Molecular Weight | 258.11200 | |
| Density | 1.422g/cm3 | Boiling Point | 323.869ºC at 760 mmHg | |
| Molecular Formula | C10H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.671ºC | |
| Name | Methyl 3-bromo-4-(dimethylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 323.869ºC at 760 mmHg |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11200 |
| Flash Point | 149.671ºC |
| Exact Mass | 257.00500 |
| PSA | 29.54000 |
| LogP | 2.30170 |
| Index of Refraction | 1.576 |
| InChIKey | OJJWGTLXWPPRHX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N(C)C)c(Br)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methyl 3-bromanyl-4-(dimethylamino)benzoate |