ethyl hydrogen carbonate , compound with 4-chloro-α,α-dimethylbenzeneethylamine (1:1) structure
|
Common Name | ethyl hydrogen carbonate , compound with 4-chloro-α,α-dimethylbenzeneethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71701-04-7 | Molecular Weight | 273.75600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-2-methylpropan-2-amine,ethyl hydrogen carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20ClNO3 |
|---|---|
| Molecular Weight | 273.75600 |
| Exact Mass | 273.11300 |
| PSA | 72.55000 |
| LogP | 4.02100 |
| InChIKey | WJOZSEJBNHCSOQ-UHFFFAOYSA-N |
| SMILES | CC(C)(N)Cc1ccc(Cl)cc1.CCOC(=O)O |
| einecs 275-860-5 |